C17H12BrN3O4S — CID 5104546
N-[(5-bromo-2-methoxyphenyl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 5104546) has the molecular formula C17H12BrN3O4S and a molecular weight of 434.27 g/mol. Its IUPAC name is N-[(5-bromo-2-methoxyphenyl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(5-bromo-2-methoxyphenyl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 5104546 |
| Molecular Formula | C17H12BrN3O4S |
| Molecular Weight | 434.27 g/mol |
| Exact Mass | 432.97 |
| IUPAC Name | N-[(5-bromo-2-methoxyphenyl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc(Br)cc1C=NNC(=O)c1cc2cc([N+](=O)[O-])ccc2s1 |
| InChI | InChI=1S/C17H12BrN3O4S/c1-25-14-4-2-12(18)6-11(14)9-19-20-17(22)16-8-10-7-13(21(23)24)3-5-15(10)26-16/h2-9H,1H3,(H,20,22) |
| InChIKey | NOAFRULYWPZFGY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.27 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|