C21H18BrN3O7S — CID 126391274
ethyl 2-[5-bromo-2-methoxy-4-[(Z)-[(5-nitro-1-benzothiophene-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 126391274) has the molecular formula C21H18BrN3O7S and a molecular weight of 536.36 g/mol. Its IUPAC name is ethyl 2-[5-bromo-2-methoxy-4-[(Z)-[(5-nitro-1-benzothiophene-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[5-bromo-2-methoxy-4-[(Z)-[(5-nitro-1-benzothiophene-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126391274 |
| Molecular Formula | C21H18BrN3O7S |
| Molecular Weight | 536.36 g/mol |
| Exact Mass | 535.00 |
| IUPAC Name | ethyl 2-[5-bromo-2-methoxy-4-[(Z)-[(5-nitro-1-benzothiophene-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(Br)c(/C=N\NC(=O)c2cc3cc([N+](=O)[O-])ccc3s2)cc1OC |
| InChI | InChI=1S/C21H18BrN3O7S/c1-3-31-20(26)11-32-17-9-15(22)13(7-16(17)30-2)10-23-24-21(27)19-8-12-6-14(25(28)29)4-5-18(12)33-19/h4-10H,3,11H2,1-2H3,(H,24,27)/b23-10- |
| InChIKey | RNRIEGDGPQNZAD-RMORIDSASA-N |
| XLogP | 4.29 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|