C26H22N4O6S — CID 126389054
N-[(Z)-[3-methoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 126389054) has the molecular formula C26H22N4O6S and a molecular weight of 518.55 g/mol. Its IUPAC name is N-[(Z)-[3-methoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(Z)-[3-methoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 126389054 |
| Molecular Formula | C26H22N4O6S |
| Molecular Weight | 518.55 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | N-[(Z)-[3-methoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)c2cc3cc([N+](=O)[O-])ccc3s2)ccc1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C26H22N4O6S/c1-16-3-6-19(7-4-16)28-25(31)15-36-21-9-5-17(11-22(21)35-2)14-27-29-26(32)24-13-18-12-20(30(33)34)8-10-23(18)37-24/h3-14H,15H2,1-2H3,(H,28,31)(H,29,32)/b27-14- |
| InChIKey | CNQSZIPFNUSEEO-VYYCAZPPSA-N |
| XLogP | 4.91 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|