C27H23BrN4O6S — CID 126388938
N-[(Z)-[3-bromo-5-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 126388938) has the molecular formula C27H23BrN4O6S and a molecular weight of 611.47 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-5-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(Z)-[3-bromo-5-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 126388938 |
| Molecular Formula | C27H23BrN4O6S |
| Molecular Weight | 611.47 g/mol |
| Exact Mass | 610.05 |
| IUPAC Name | N-[(Z)-[3-bromo-5-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2cc3cc([N+](=O)[O-])ccc3s2)cc(Br)c1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C27H23BrN4O6S/c1-3-37-22-11-17(10-21(28)26(22)38-15-25(33)30-19-6-4-16(2)5-7-19)14-29-31-27(34)24-13-18-12-20(32(35)36)8-9-23(18)39-24/h4-14H,3,15H2,1-2H3,(H,30,33)(H,31,34)/b29-14- |
| InChIKey | BRRQMWOYBQMZFR-NUJZUDFISA-N |
| XLogP | 6.06 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.47 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|