C24H17Cl2N3O4S — CID 126389509
N-[(Z)-[3,5-dichloro-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 126389509) has the molecular formula C24H17Cl2N3O4S and a molecular weight of 514.39 g/mol. Its IUPAC name is N-[(Z)-[3,5-dichloro-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(Z)-[3,5-dichloro-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 126389509 |
| Molecular Formula | C24H17Cl2N3O4S |
| Molecular Weight | 514.39 g/mol |
| Exact Mass | 513.03 |
| IUPAC Name | N-[(Z)-[3,5-dichloro-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc(COc2c(Cl)cc(/C=N\NC(=O)c3cc4cc([N+](=O)[O-])ccc4s3)cc2Cl)cc1 |
| InChI | InChI=1S/C24H17Cl2N3O4S/c1-14-2-4-15(5-3-14)13-33-23-19(25)8-16(9-20(23)26)12-27-28-24(30)22-11-17-10-18(29(31)32)6-7-21(17)34-22/h2-12H,13H2,1H3,(H,28,30)/b27-12- |
| InChIKey | GYZMLDMATKINKD-PPDIBHTLSA-N |
| XLogP | 6.77 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.39 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|