C28H23Cl2N3O5S — CID 126392452
N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 126392452) has the molecular formula C28H23Cl2N3O5S and a molecular weight of 584.48 g/mol. Its IUPAC name is N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 126392452 |
| Molecular Formula | C28H23Cl2N3O5S |
| Molecular Weight | 584.48 g/mol |
| Exact Mass | 583.07 |
| IUPAC Name | N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | C=CCc1cc(/C=N\NC(=O)c2cc3cc([N+](=O)[O-])ccc3s2)cc(OCC)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H23Cl2N3O5S/c1-3-5-19-10-18(12-24(37-4-2)27(19)38-16-17-6-8-22(29)23(30)11-17)15-31-32-28(34)26-14-20-13-21(33(35)36)7-9-25(20)39-26/h3,6-15H,1,4-5,16H2,2H3,(H,32,34)/b31-15- |
| InChIKey | YEONDNSENBRDRM-BVMLUPFRSA-N |
| XLogP | 7.59 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.48 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|