C28H22Br2Cl2N2O4 — CID 21376180
5,7-dibromo-N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 21376180) has the molecular formula C28H22Br2Cl2N2O4 and a molecular weight of 681.21 g/mol. Its IUPAC name is 5,7-dibromo-N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21376180 |
| Molecular Formula | C28H22Br2Cl2N2O4 |
| Molecular Weight | 681.21 g/mol |
| Exact Mass | 677.93 |
| IUPAC Name | 5,7-dibromo-N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | C=CCc1cc(/C=N\NC(=O)c2cc3cc(Br)cc(Br)c3o2)cc(OCC)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H22Br2Cl2N2O4/c1-3-5-18-8-17(10-24(36-4-2)27(18)37-15-16-6-7-22(31)23(32)9-16)14-33-34-28(35)25-12-19-11-20(29)13-21(30)26(19)38-25/h3,6-14H,1,4-5,15H2,2H3,(H,34,35)/b33-14- |
| InChIKey | PIDUFUWSTICGQV-DMWKKASYSA-N |
| XLogP | 8.73 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.21 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|