C19H15Br2IN2O4 — CID 21375614
5,7-dibromo-N-[(E)-(4-ethoxy-3-iodo-5-methoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 21375614) has the molecular formula C19H15Br2IN2O4 and a molecular weight of 622.05 g/mol. Its IUPAC name is 5,7-dibromo-N-[(E)-(4-ethoxy-3-iodo-5-methoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(E)-(4-ethoxy-3-iodo-5-methoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21375614 |
| Molecular Formula | C19H15Br2IN2O4 |
| Molecular Weight | 622.05 g/mol |
| Exact Mass | 619.84 |
| IUPAC Name | 5,7-dibromo-N-[(E)-(4-ethoxy-3-iodo-5-methoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | CCOc1c(I)cc(/C=N/NC(=O)c2cc3cc(Br)cc(Br)c3o2)cc1OC |
| InChI | InChI=1S/C19H15Br2IN2O4/c1-3-27-18-14(22)4-10(5-15(18)26-2)9-23-24-19(25)16-7-11-6-12(20)8-13(21)17(11)28-16/h4-9H,3H2,1-2H3,(H,24,25)/b23-9+ |
| InChIKey | CVBWZXRRBGTJFM-NUGSKGIGSA-N |
| XLogP | 5.73 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.05 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|