C28H19Br2IN2O4 — CID 21375541
5,7-dibromo-N-[(Z)-[3-iodo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 21375541) has the molecular formula C28H19Br2IN2O4 and a molecular weight of 734.18 g/mol. Its IUPAC name is 5,7-dibromo-N-[(Z)-[3-iodo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(Z)-[3-iodo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21375541 |
| Molecular Formula | C28H19Br2IN2O4 |
| Molecular Weight | 734.18 g/mol |
| Exact Mass | 731.88 |
| IUPAC Name | 5,7-dibromo-N-[(Z)-[3-iodo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)c2cc3cc(Br)cc(Br)c3o2)cc(I)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C28H19Br2IN2O4/c1-35-24-10-16(14-32-33-28(34)25-12-19-11-20(29)13-22(30)26(19)37-25)9-23(31)27(24)36-15-18-7-4-6-17-5-2-3-8-21(17)18/h2-14H,15H2,1H3,(H,33,34)/b32-14- |
| InChIKey | OVLSWVZRDBXBEX-LPEPFOFCSA-N |
| XLogP | 8.07 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.18 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|