C29H21Br2IN2O4 — CID 126025290
5-bromo-N-[(Z)-[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-7-iodo-1-benzofuran-2-carboxamide (PubChem CID 126025290) has the molecular formula C29H21Br2IN2O4 and a molecular weight of 748.21 g/mol. Its IUPAC name is 5-bromo-N-[(Z)-[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-7-iodo-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-[(Z)-[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-7-iodo-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126025290 |
| Molecular Formula | C29H21Br2IN2O4 |
| Molecular Weight | 748.21 g/mol |
| Exact Mass | 745.89 |
| IUPAC Name | 5-bromo-N-[(Z)-[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-7-iodo-1-benzofuran-2-carboxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2cc3cc(Br)cc(I)c3o2)cc(Br)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C29H21Br2IN2O4/c1-2-36-25-11-17(15-33-34-29(35)26-13-20-12-21(30)14-24(32)27(20)38-26)10-23(31)28(25)37-16-19-8-5-7-18-6-3-4-9-22(18)19/h3-15H,2,16H2,1H3,(H,34,35)/b33-15- |
| InChIKey | XUHZCBPAOVEDPB-UHIZKJEFSA-N |
| XLogP | 8.46 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.21 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|