C26H23BrN2O4 — CID 4673051
N-[[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-methylfuran-2-carboxamide (PubChem CID 4673051) has the molecular formula C26H23BrN2O4 and a molecular weight of 507.38 g/mol. Its IUPAC name is N-[[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-methylfuran-2-carboxamide.
| Compound Name | N-[[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 4673051 |
| Molecular Formula | C26H23BrN2O4 |
| Molecular Weight | 507.38 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | N-[[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-methylfuran-2-carboxamide |
| SMILES | CCOc1cc(C=NNC(=O)c2ccc(C)o2)cc(Br)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C26H23BrN2O4/c1-3-31-24-14-18(15-28-29-26(30)23-12-11-17(2)33-23)13-22(27)25(24)32-16-20-9-6-8-19-7-4-5-10-21(19)20/h4-15H,3,16H2,1-2H3,(H,29,30) |
| InChIKey | MUGMRZBARINUDY-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.38 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|