C26H23BrN2O2 — CID 94851477
N-[(Z)-[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]aniline (PubChem CID 94851477) has the molecular formula C26H23BrN2O2 and a molecular weight of 475.39 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]aniline.
| Compound Name | N-[(Z)-[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 94851477 |
| Molecular Formula | C26H23BrN2O2 |
| Molecular Weight | 475.39 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | N-[(Z)-[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]aniline |
| SMILES | CCOc1cc(/C=N\Nc2ccccc2)cc(Br)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C26H23BrN2O2/c1-2-30-25-16-19(17-28-29-22-12-4-3-5-13-22)15-24(27)26(25)31-18-21-11-8-10-20-9-6-7-14-23(20)21/h3-17,29H,2,18H2,1H3/b28-17- |
| InChIKey | YYIFBIMPCVVQLW-QRQIAZFYSA-N |
| XLogP | 7.03 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.39 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|