C17H17BrN2O3 — CID 169383230
[2-bromo-6-ethoxy-4-[(phenylhydrazinylidene)methyl]phenyl] acetate (PubChem CID 169383230) has the molecular formula C17H17BrN2O3 and a molecular weight of 377.24 g/mol. Its IUPAC name is [2-bromo-6-ethoxy-4-[(phenylhydrazinylidene)methyl]phenyl] acetate.
| Compound Name | [2-bromo-6-ethoxy-4-[(phenylhydrazinylidene)methyl]phenyl] acetate |
|---|---|
| PubChem CID | 169383230 |
| Molecular Formula | C17H17BrN2O3 |
| Molecular Weight | 377.24 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | [2-bromo-6-ethoxy-4-[(phenylhydrazinylidene)methyl]phenyl] acetate |
| SMILES | CCOc1cc(C=NNc2ccccc2)cc(Br)c1OC(C)=O |
| InChI | InChI=1S/C17H17BrN2O3/c1-3-22-16-10-13(9-15(18)17(16)23-12(2)21)11-19-20-14-7-5-4-6-8-14/h4-11,20H,3H2,1-2H3 |
| InChIKey | FTQAZEMRAHRKKD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.24 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|