C18H18BrF3N2O2 — CID 110841950
N-[(3-bromo-4,5-diethoxyphenyl)methylideneamino]-4-(trifluoromethyl)aniline (PubChem CID 110841950) has the molecular formula C18H18BrF3N2O2 and a molecular weight of 431.25 g/mol. Its IUPAC name is N-[(3-bromo-4,5-diethoxyphenyl)methylideneamino]-4-(trifluoromethyl)aniline.
| Compound Name | N-[(3-bromo-4,5-diethoxyphenyl)methylideneamino]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 110841950 |
| Molecular Formula | C18H18BrF3N2O2 |
| Molecular Weight | 431.25 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | N-[(3-bromo-4,5-diethoxyphenyl)methylideneamino]-4-(trifluoromethyl)aniline |
| SMILES | CCOc1cc(C=NNc2ccc(C(F)(F)F)cc2)cc(Br)c1OCC |
| InChI | InChI=1S/C18H18BrF3N2O2/c1-3-25-16-10-12(9-15(19)17(16)26-4-2)11-23-24-14-7-5-13(6-8-14)18(20,21)22/h5-11,24H,3-4H2,1-2H3 |
| InChIKey | HTVLDUYFDWBFTG-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.25 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|