C22H18BrF4N3O2 — CID 126106639
N-[(Z)-[3-bromo-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 126106639) has the molecular formula C22H18BrF4N3O2 and a molecular weight of 512.30 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(Z)-[3-bromo-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 126106639 |
| Molecular Formula | C22H18BrF4N3O2 |
| Molecular Weight | 512.30 g/mol |
| Exact Mass | 511.05 |
| IUPAC Name | N-[(Z)-[3-bromo-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCOc1cc(/C=N\Nc2ccc(C(F)(F)F)cn2)cc(Br)c1OCc1cccc(F)c1 |
| InChI | InChI=1S/C22H18BrF4N3O2/c1-2-31-19-10-15(11-29-30-20-7-6-16(12-28-20)22(25,26)27)9-18(23)21(19)32-13-14-4-3-5-17(24)8-14/h3-12H,2,13H2,1H3,(H,28,30)/b29-11- |
| InChIKey | UYILXVGYFOYWJM-KYMQWJLESA-N |
| XLogP | 6.43 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.30 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|