C21H16F4IN3O2 — CID 126094682
N-[(Z)-[4-[(3-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 126094682) has the molecular formula C21H16F4IN3O2 and a molecular weight of 545.27 g/mol. Its IUPAC name is N-[(Z)-[4-[(3-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(Z)-[4-[(3-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 126094682 |
| Molecular Formula | C21H16F4IN3O2 |
| Molecular Weight | 545.27 g/mol |
| Exact Mass | 545.02 |
| IUPAC Name | N-[(Z)-[4-[(3-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | COc1cc(/C=N\Nc2ccc(C(F)(F)F)cn2)cc(I)c1OCc1cccc(F)c1 |
| InChI | InChI=1S/C21H16F4IN3O2/c1-30-18-9-14(10-28-29-19-6-5-15(11-27-19)21(23,24)25)8-17(26)20(18)31-12-13-3-2-4-16(22)7-13/h2-11H,12H2,1H3,(H,27,29)/b28-10- |
| InChIKey | LBJUQLFKYWHKRD-LGUSAWBASA-N |
| XLogP | 5.88 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.27 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|