C21H13F3I2N4O — CID 126115234
2-[[2,6-diiodo-4-[(Z)-[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]methyl]benzonitrile (PubChem CID 126115234) has the molecular formula C21H13F3I2N4O and a molecular weight of 648.16 g/mol. Its IUPAC name is 2-[[2,6-diiodo-4-[(Z)-[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2,6-diiodo-4-[(Z)-[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126115234 |
| Molecular Formula | C21H13F3I2N4O |
| Molecular Weight | 648.16 g/mol |
| Exact Mass | 647.91 |
| IUPAC Name | 2-[[2,6-diiodo-4-[(Z)-[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1COc1c(I)cc(/C=N\Nc2ccc(C(F)(F)F)cn2)cc1I |
| InChI | InChI=1S/C21H13F3I2N4O/c22-21(23,24)16-5-6-19(28-11-16)30-29-10-13-7-17(25)20(18(26)8-13)31-12-15-4-2-1-3-14(15)9-27/h1-8,10-11H,12H2,(H,28,30)/b29-10- |
| InChIKey | WXKOBXAQIZWMML-DANHRZQXSA-N |
| XLogP | 6.21 |
| TPSA | 70.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.16 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|