C21H13Cl2F3N4O — CID 126108267
2-[[2,6-dichloro-4-[(Z)-[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]methyl]benzonitrile (PubChem CID 126108267) has the molecular formula C21H13Cl2F3N4O and a molecular weight of 465.26 g/mol. Its IUPAC name is 2-[[2,6-dichloro-4-[(Z)-[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2,6-dichloro-4-[(Z)-[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126108267 |
| Molecular Formula | C21H13Cl2F3N4O |
| Molecular Weight | 465.26 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | 2-[[2,6-dichloro-4-[(Z)-[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1COc1c(Cl)cc(/C=N\Nc2ccc(C(F)(F)F)cn2)cc1Cl |
| InChI | InChI=1S/C21H13Cl2F3N4O/c22-17-7-13(10-29-30-19-6-5-16(11-28-19)21(24,25)26)8-18(23)20(17)31-12-15-4-2-1-3-14(15)9-27/h1-8,10-11H,12H2,(H,28,30)/b29-10- |
| InChIKey | BXTDOTHGXRMAFS-DANHRZQXSA-N |
| XLogP | 6.30 |
| TPSA | 70.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.26 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|