C20H15ClF3N3O — CID 126124508
N-[(Z)-[4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 126124508) has the molecular formula C20H15ClF3N3O and a molecular weight of 405.81 g/mol. Its IUPAC name is N-[(Z)-[4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(Z)-[4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 126124508 |
| Molecular Formula | C20H15ClF3N3O |
| Molecular Weight | 405.81 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | N-[(Z)-[4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1ccc(N/N=C\c2ccc(OCc3ccccc3Cl)cc2)nc1 |
| InChI | InChI=1S/C20H15ClF3N3O/c21-18-4-2-1-3-15(18)13-28-17-8-5-14(6-9-17)11-26-27-19-10-7-16(12-25-19)20(22,23)24/h1-12H,13H2,(H,25,27)/b26-11- |
| InChIKey | PDFMZQFQMWKYSP-RAWMCFOBSA-N |
| XLogP | 5.78 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.81 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|