C13H9ClF3N3 — CID 6162877
N-[(Z)-(3-chlorophenyl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 6162877) has the molecular formula C13H9ClF3N3 and a molecular weight of 299.68 g/mol. Its IUPAC name is N-[(Z)-(3-chlorophenyl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(Z)-(3-chlorophenyl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 6162877 |
| Molecular Formula | C13H9ClF3N3 |
| Molecular Weight | 299.68 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | N-[(Z)-(3-chlorophenyl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1ccc(N/N=C\c2cccc(Cl)c2)nc1 |
| InChI | InChI=1S/C13H9ClF3N3/c14-11-3-1-2-9(6-11)7-19-20-12-5-4-10(8-18-12)13(15,16)17/h1-8H,(H,18,20)/b19-7- |
| InChIKey | CCBYJHURENFCTF-GXHLCREISA-N |
| XLogP | 4.20 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.68 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|