C17H10Cl2F3N3O — CID 126109835
N-[(E)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 126109835) has the molecular formula C17H10Cl2F3N3O and a molecular weight of 400.19 g/mol. Its IUPAC name is N-[(E)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(E)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 126109835 |
| Molecular Formula | C17H10Cl2F3N3O |
| Molecular Weight | 400.19 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | N-[(E)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1ccc(N/N=C/c2ccc(-c3ccc(Cl)cc3Cl)o2)nc1 |
| InChI | InChI=1S/C17H10Cl2F3N3O/c18-11-2-4-13(14(19)7-11)15-5-3-12(26-15)9-24-25-16-6-1-10(8-23-16)17(20,21)22/h1-9H,(H,23,25)/b24-9+ |
| InChIKey | WUMPUEPNHLZCAK-PGGKNCGUSA-N |
| XLogP | 6.11 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.19 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|