C20H13BrCl2F3N3O — CID 126082411
N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 126082411) has the molecular formula C20H13BrCl2F3N3O and a molecular weight of 519.15 g/mol. Its IUPAC name is N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 126082411 |
| Molecular Formula | C20H13BrCl2F3N3O |
| Molecular Weight | 519.15 g/mol |
| Exact Mass | 516.96 |
| IUPAC Name | N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1ccc(N/N=C\c2cc(Br)ccc2OCc2ccc(Cl)cc2Cl)nc1 |
| InChI | InChI=1S/C20H13BrCl2F3N3O/c21-15-3-5-18(30-11-12-1-4-16(22)8-17(12)23)13(7-15)9-28-29-19-6-2-14(10-27-19)20(24,25)26/h1-10H,11H2,(H,27,29)/b28-9- |
| InChIKey | WZZQYXUKAKAOEM-BMWVXGTQSA-N |
| XLogP | 7.19 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.15 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|