C24H20BrCl2N7O — CID 6288694
2-N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-6-N-methyl-4-N-phenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 6288694) has the molecular formula C24H20BrCl2N7O and a molecular weight of 573.28 g/mol. Its IUPAC name is 2-N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-6-N-methyl-4-N-phenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-6-N-methyl-4-N-phenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 6288694 |
| Molecular Formula | C24H20BrCl2N7O |
| Molecular Weight | 573.28 g/mol |
| Exact Mass | 571.03 |
| IUPAC Name | 2-N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-6-N-methyl-4-N-phenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(N/N=C\c2cc(Br)ccc2OCc2ccc(Cl)cc2Cl)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C24H20BrCl2N7O/c1-28-22-31-23(30-19-5-3-2-4-6-19)33-24(32-22)34-29-13-16-11-17(25)8-10-21(16)35-14-15-7-9-18(26)12-20(15)27/h2-13H,14H2,1H3,(H3,28,30,31,32,33,34)/b29-13- |
| InChIKey | JXBBRTQTQFVQAM-DBFSUHOCSA-N |
| XLogP | 6.75 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.28 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|