C24H19BrCl3N3O3 — CID 3954725
N'-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-N-(3-chlorophenyl)butanediamide (PubChem CID 3954725) has the molecular formula C24H19BrCl3N3O3 and a molecular weight of 583.70 g/mol. Its IUPAC name is N'-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-N-(3-chlorophenyl)butanediamide.
| Compound Name | N'-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-N-(3-chlorophenyl)butanediamide |
|---|---|
| PubChem CID | 3954725 |
| Molecular Formula | C24H19BrCl3N3O3 |
| Molecular Weight | 583.70 g/mol |
| Exact Mass | 580.97 |
| IUPAC Name | N'-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-N-(3-chlorophenyl)butanediamide |
| SMILES | O=C(CCC(=O)Nc1cccc(Cl)c1)NN=Cc1cc(Br)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H19BrCl3N3O3/c25-17-5-7-22(34-14-15-4-6-19(27)12-21(15)28)16(10-17)13-29-31-24(33)9-8-23(32)30-20-3-1-2-18(26)11-20/h1-7,10-13H,8-9,14H2,(H,30,32)(H,31,33) |
| InChIKey | CNXFRTIHDXOYCY-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.70 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|