C24H20BrCl2N3O3 — CID 3912997
N'-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-N-phenylbutanediamide (PubChem CID 3912997) has the molecular formula C24H20BrCl2N3O3 and a molecular weight of 549.25 g/mol. Its IUPAC name is N'-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-N-phenylbutanediamide.
| Compound Name | N'-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-N-phenylbutanediamide |
|---|---|
| PubChem CID | 3912997 |
| Molecular Formula | C24H20BrCl2N3O3 |
| Molecular Weight | 549.25 g/mol |
| Exact Mass | 547.01 |
| IUPAC Name | N'-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-N-phenylbutanediamide |
| SMILES | O=C(CCC(=O)Nc1ccccc1)NN=Cc1ccc(OCc2ccc(Cl)cc2Cl)c(Br)c1 |
| InChI | InChI=1S/C24H20BrCl2N3O3/c25-20-12-16(6-9-22(20)33-15-17-7-8-18(26)13-21(17)27)14-28-30-24(32)11-10-23(31)29-19-4-2-1-3-5-19/h1-9,12-14H,10-11,15H2,(H,29,31)(H,30,32) |
| InChIKey | YCFIDJZCBOPZFC-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.25 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|