C28H27Cl3FN7O — CID 171150801
2-N-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N-(4-fluorophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine;hydrochloride (PubChem CID 171150801) has the molecular formula C28H27Cl3FN7O and a molecular weight of 602.93 g/mol. Its IUPAC name is 2-N-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N-(4-fluorophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine;hydrochloride.
| Compound Name | 2-N-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N-(4-fluorophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 171150801 |
| Molecular Formula | C28H27Cl3FN7O |
| Molecular Weight | 602.93 g/mol |
| Exact Mass | 601.13 |
| IUPAC Name | 2-N-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N-(4-fluorophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine;hydrochloride |
| SMILES | Cl.Fc1ccc(Nc2nc(NN=Cc3ccccc3OCc3ccc(Cl)cc3Cl)nc(N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C28H26Cl2FN7O.ClH/c29-21-9-8-20(24(30)16-21)18-39-25-7-3-2-6-19(25)17-32-37-27-34-26(33-23-12-10-22(31)11-13-23)35-28(36-27)38-14-4-1-5-15-38;/h2-3,6-13,16-17H,1,4-5,14-15,18H2,(H2,33,34,35,36,37);1H |
| InChIKey | WPYXJUIGZSYNBY-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.93 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|