C21H22ClF2N7 — CID 91962248
4-N-(4-fluorophenyl)-2-N-[(2-fluorophenyl)methylideneamino]-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine;hydrochloride (PubChem CID 91962248) has the molecular formula C21H22ClF2N7 and a molecular weight of 445.91 g/mol. Its IUPAC name is 4-N-(4-fluorophenyl)-2-N-[(2-fluorophenyl)methylideneamino]-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine;hydrochloride.
| Compound Name | 4-N-(4-fluorophenyl)-2-N-[(2-fluorophenyl)methylideneamino]-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 91962248 |
| Molecular Formula | C21H22ClF2N7 |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 4-N-(4-fluorophenyl)-2-N-[(2-fluorophenyl)methylideneamino]-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine;hydrochloride |
| SMILES | Cl.Fc1ccc(Nc2nc(NN=Cc3ccccc3F)nc(N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C21H21F2N7.ClH/c22-16-8-10-17(11-9-16)25-19-26-20(28-21(27-19)30-12-4-1-5-13-30)29-24-14-15-6-2-3-7-18(15)23;/h2-3,6-11,14H,1,4-5,12-13H2,(H2,25,26,27,28,29);1H |
| InChIKey | LDUXHDAHQPKFMZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|