C19H21ClFN7O — CID 126467803
4-N-(4-fluorophenyl)-2-N-[(Z)-furan-2-ylmethylideneamino]-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine;hydrochloride (PubChem CID 126467803) has the molecular formula C19H21ClFN7O and a molecular weight of 417.88 g/mol. Its IUPAC name is 4-N-(4-fluorophenyl)-2-N-[(Z)-furan-2-ylmethylideneamino]-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine;hydrochloride.
| Compound Name | 4-N-(4-fluorophenyl)-2-N-[(Z)-furan-2-ylmethylideneamino]-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 126467803 |
| Molecular Formula | C19H21ClFN7O |
| Molecular Weight | 417.88 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 4-N-(4-fluorophenyl)-2-N-[(Z)-furan-2-ylmethylideneamino]-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine;hydrochloride |
| SMILES | Cl.Fc1ccc(Nc2nc(N/N=C\c3ccco3)nc(N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C19H20FN7O.ClH/c20-14-6-8-15(9-7-14)22-17-23-18(26-21-13-16-5-4-12-28-16)25-19(24-17)27-10-2-1-3-11-27;/h4-9,12-13H,1-3,10-11H2,(H2,22,23,24,25,26);1H/b21-13-; |
| InChIKey | YAGPIZQYDVZNIF-GNWMQEPYSA-N |
| XLogP | 4.21 |
| TPSA | 91.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.88 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|