C22H22F3N7 — CID 5187463
4-N-phenyl-6-piperidin-1-yl-2-N-[[2-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine (PubChem CID 5187463) has the molecular formula C22H22F3N7 and a molecular weight of 441.46 g/mol. Its IUPAC name is 4-N-phenyl-6-piperidin-1-yl-2-N-[[2-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-phenyl-6-piperidin-1-yl-2-N-[[2-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 5187463 |
| Molecular Formula | C22H22F3N7 |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 4-N-phenyl-6-piperidin-1-yl-2-N-[[2-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine |
| SMILES | FC(F)(F)c1ccccc1C=NNc1nc(Nc2ccccc2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C22H22F3N7/c23-22(24,25)18-12-6-5-9-16(18)15-26-31-20-28-19(27-17-10-3-1-4-11-17)29-21(30-20)32-13-7-2-8-14-32/h1,3-6,9-12,15H,2,7-8,13-14H2,(H2,27,28,29,30,31) |
| InChIKey | VYEYNXYGEZNVMX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|