C19H20N8 — CID 56688382
4-N-phenyl-2-N-[(E)-pyridin-3-ylmethylideneamino]-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 56688382) has the molecular formula C19H20N8 and a molecular weight of 360.43 g/mol. Its IUPAC name is 4-N-phenyl-2-N-[(E)-pyridin-3-ylmethylideneamino]-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-phenyl-2-N-[(E)-pyridin-3-ylmethylideneamino]-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 56688382 |
| Molecular Formula | C19H20N8 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 4-N-phenyl-2-N-[(E)-pyridin-3-ylmethylideneamino]-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | C(=N/Nc1nc(Nc2ccccc2)nc(N2CCCC2)n1)\c1cccnc1 |
| InChI | InChI=1S/C19H20N8/c1-2-8-16(9-3-1)22-17-23-18(25-19(24-17)27-11-4-5-12-27)26-21-14-15-7-6-10-20-13-15/h1-3,6-10,13-14H,4-5,11-12H2,(H2,22,23,24,25,26)/b21-14+ |
| InChIKey | ZAXSWEAEWWBSCE-KGENOOAVSA-N |
| XLogP | 3.06 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|