C20H21N7O2 — CID 3667808
4-[[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenol (PubChem CID 3667808) has the molecular formula C20H21N7O2 and a molecular weight of 391.44 g/mol. Its IUPAC name is 4-[[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 4-[[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 3667808 |
| Molecular Formula | C20H21N7O2 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 4-[[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenol |
| SMILES | Oc1ccc(C=NNc2nc(Nc3ccccc3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C20H21N7O2/c28-17-8-6-15(7-9-17)14-21-26-19-23-18(22-16-4-2-1-3-5-16)24-20(25-19)27-10-12-29-13-11-27/h1-9,14,28H,10-13H2,(H2,22,23,24,25,26) |
| InChIKey | BVGHGZGOVOGANH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|