C16H21N7O3 — CID 5441896
(2S,3Z)-3-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]propane-1,2-diol (PubChem CID 5441896) has the molecular formula C16H21N7O3 and a molecular weight of 359.39 g/mol. Its IUPAC name is (2S,3Z)-3-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]propane-1,2-diol.
| Compound Name | (2S,3Z)-3-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]propane-1,2-diol |
|---|---|
| PubChem CID | 5441896 |
| Molecular Formula | C16H21N7O3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | (2S,3Z)-3-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]propane-1,2-diol |
| SMILES | OC[C@@H](O)/C=N\Nc1nc(Nc2ccccc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C16H21N7O3/c24-11-13(25)10-17-22-15-19-14(18-12-4-2-1-3-5-12)20-16(21-15)23-6-8-26-9-7-23/h1-5,10,13,24-25H,6-9,11H2,(H2,18,19,20,21,22)/b17-10-/t13-/m0/s1 |
| InChIKey | XIOJQBMJFKNFSX-NWRYFCBHSA-N |
| XLogP | 0.20 |
| TPSA | 128.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|