C20H20N6O3 — CID 4767474
4-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]benzoic acid (PubChem CID 4767474) has the molecular formula C20H20N6O3 and a molecular weight of 392.42 g/mol. Its IUPAC name is 4-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]benzoic acid.
| Compound Name | 4-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 4767474 |
| Molecular Formula | C20H20N6O3 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 4-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2nc(Nc3ccccc3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C20H20N6O3/c27-17(28)14-6-8-16(9-7-14)22-19-23-18(21-15-4-2-1-3-5-15)24-20(25-19)26-10-12-29-13-11-26/h1-9H,10-13H2,(H,27,28)(H2,21,22,23,24,25) |
| InChIKey | ASIHRLBCYAIDCO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |