C31H28N6O — CID 10074710
6-morpholin-4-yl-2-N,4-N-bis(4-phenylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 10074710) has the molecular formula C31H28N6O and a molecular weight of 500.61 g/mol. Its IUPAC name is 6-morpholin-4-yl-2-N,4-N-bis(4-phenylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-morpholin-4-yl-2-N,4-N-bis(4-phenylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 10074710 |
| Molecular Formula | C31H28N6O |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | 6-morpholin-4-yl-2-N,4-N-bis(4-phenylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | c1ccc(-c2ccc(Nc3nc(Nc4ccc(-c5ccccc5)cc4)nc(N4CCOCC4)n3)cc2)cc1 |
| InChI | InChI=1S/C31H28N6O/c1-3-7-23(8-4-1)25-11-15-27(16-12-25)32-29-34-30(36-31(35-29)37-19-21-38-22-20-37)33-28-17-13-26(14-18-28)24-9-5-2-6-10-24/h1-18H,19-22H2,(H2,32,33,34,35,36) |
| InChIKey | JTHLOWYUBJUBQK-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |