C40H38N12Na2O8S2 — CID 87429171
disodium;1,2-bis[4-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]phenyl]ethene-1,2-disulfonate (PubChem CID 87429171) has the molecular formula C40H38N12Na2O8S2 and a molecular weight of 924.93 g/mol. Its IUPAC name is disodium;1,2-bis[4-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]phenyl]ethene-1,2-disulfonate.
| Compound Name | disodium;1,2-bis[4-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]phenyl]ethene-1,2-disulfonate |
|---|---|
| PubChem CID | 87429171 |
| Molecular Formula | C40H38N12Na2O8S2 |
| Molecular Weight | 924.93 g/mol |
| Exact Mass | 924.22 |
| IUPAC Name | disodium;1,2-bis[4-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]phenyl]ethene-1,2-disulfonate |
| SMILES | O=S(=O)([O-])C(=C(c1ccc(Nc2nc(Nc3ccccc3)nc(N3CCOCC3)n2)cc1)S(=O)(=O)[O-])c1ccc(Nc2nc(Nc3ccccc3)nc(N3CCOCC3)n2)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C40H40N12O8S2.2Na/c53-61(54,55)33(27-11-15-31(16-12-27)43-37-45-35(41-29-7-3-1-4-8-29)47-39(49-37)51-19-23-59-24-20-51)34(62(56,57)58)28-13-17-32(18-14-28)44-38-46-36(42-30-9-5-2-6-10-30)48-40(50-38)52-21-25-60-26-22-52;;/h1-18H,19-26H2,(H,53,54,55)(H,56,57,58)(H2,41,43,45,47,49)(H2,42,44,46,48,50);;/q;2*+1/p-2 |
| InChIKey | ITGOLZKJQCTOND-UHFFFAOYSA-L |
| XLogP | -1.37 |
| TPSA | 264.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.93 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|