C40H40N12NaO8S2 — CID 87917809
CID 87917809 (PubChem CID 87917809) has the molecular formula C40H40N12NaO8S2 and a molecular weight of 903.96 g/mol.
| Compound Name | CID 87917809 |
|---|---|
| PubChem CID | 87917809 |
| Molecular Formula | C40H40N12NaO8S2 |
| Molecular Weight | 903.96 g/mol |
| Exact Mass | 903.24 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1cc(Nc2nc(Nc3ccccc3)nc(N3CCOCC3)n2)ccc1/C=C/c1ccc(Nc2nc(Nc3ccccc3)nc(N3CCOCC3)n2)cc1S(=O)(=O)O.[Na] |
| InChI | InChI=1S/C40H40N12O8S2.Na/c53-61(54,55)33-25-31(43-37-45-35(41-29-7-3-1-4-8-29)47-39(49-37)51-17-21-59-22-18-51)15-13-27(33)11-12-28-14-16-32(26-34(28)62(56,57)58)44-38-46-36(42-30-9-5-2-6-10-30)48-40(50-38)52-19-23-60-24-20-52;/h1-16,25-26H,17-24H2,(H,53,54,55)(H,56,57,58)(H2,41,43,45,47,49)(H2,42,44,46,48,50);/b12-11+; |
| InChIKey | TZQCHFJTWLCRBA-CALJPSDSSA-N |
| XLogP | 4.99 |
| TPSA | 259.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.96 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|