C16H20N6O4S — CID 58661566
5-[(4-amino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-2-[(E)-prop-1-enyl]benzenesulfonic acid (PubChem CID 58661566) has the molecular formula C16H20N6O4S and a molecular weight of 392.44 g/mol. Its IUPAC name is 5-[(4-amino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-2-[(E)-prop-1-enyl]benzenesulfonic acid.
| Compound Name | 5-[(4-amino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-2-[(E)-prop-1-enyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 58661566 |
| Molecular Formula | C16H20N6O4S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 5-[(4-amino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-2-[(E)-prop-1-enyl]benzenesulfonic acid |
| SMILES | C/C=C/c1ccc(Nc2nc(N)nc(N3CCOCC3)n2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C16H20N6O4S/c1-2-3-11-4-5-12(10-13(11)27(23,24)25)18-15-19-14(17)20-16(21-15)22-6-8-26-9-7-22/h2-5,10H,6-9H2,1H3,(H,23,24,25)(H3,17,18,19,20,21)/b3-2+ |
| InChIKey | YWFOYVXXVYBFLH-NSCUHMNNSA-N |
| XLogP | 1.31 |
| TPSA | 143.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|