C36H44N12Na2O10S2 — CID 173063284
CID 173063284 (PubChem CID 173063284) has the molecular formula C36H44N12Na2O10S2 and a molecular weight of 914.94 g/mol.
| Compound Name | CID 173063284 |
|---|---|
| PubChem CID | 173063284 |
| Molecular Formula | C36H44N12Na2O10S2 |
| Molecular Weight | 914.94 g/mol |
| Exact Mass | 914.25 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1cc(Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)ccc1C=Cc1ccc(Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)cc1S(=O)(=O)O.[Na].[Na] |
| InChI | InChI=1S/C36H44N12O10S2.2Na/c49-59(50,51)29-23-27(37-31-39-33(45-7-15-55-16-8-45)43-34(40-31)46-9-17-56-18-10-46)5-3-25(29)1-2-26-4-6-28(24-30(26)60(52,53)54)38-32-41-35(47-11-19-57-20-12-47)44-36(42-32)48-13-21-58-22-14-48;;/h1-6,23-24H,7-22H2,(H,49,50,51)(H,52,53,54)(H,37,39,40,43)(H,38,41,42,44);; |
| InChIKey | KGGNFLTWHQLFPS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 260.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.94 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|