C28H28N6O7S2 — CID 175866375
5-[[4-(2-methylanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]-2-[2-(2-sulfophenyl)ethenyl]benzenesulfonic acid (PubChem CID 175866375) has the molecular formula C28H28N6O7S2 and a molecular weight of 624.70 g/mol. Its IUPAC name is 5-[[4-(2-methylanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]-2-[2-(2-sulfophenyl)ethenyl]benzenesulfonic acid.
| Compound Name | 5-[[4-(2-methylanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]-2-[2-(2-sulfophenyl)ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 175866375 |
| Molecular Formula | C28H28N6O7S2 |
| Molecular Weight | 624.70 g/mol |
| Exact Mass | 624.15 |
| IUPAC Name | 5-[[4-(2-methylanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]-2-[2-(2-sulfophenyl)ethenyl]benzenesulfonic acid |
| SMILES | Cc1ccccc1Nc1nc(Nc2ccc(C=Cc3ccccc3S(=O)(=O)O)c(S(=O)(=O)O)c2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C28H28N6O7S2/c1-19-6-2-4-8-23(19)30-27-31-26(32-28(33-27)34-14-16-41-17-15-34)29-22-13-12-21(25(18-22)43(38,39)40)11-10-20-7-3-5-9-24(20)42(35,36)37/h2-13,18H,14-17H2,1H3,(H,35,36,37)(H,38,39,40)(H2,29,30,31,32,33) |
| InChIKey | YQOXIRYHNQQAOU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 183.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.70 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|