C26H26ClN9O9S2 — CID 87355406
2-[2-[4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]ethenyl]-5-[(4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]benzenesulfonic acid (PubChem CID 87355406) has the molecular formula C26H26ClN9O9S2 and a molecular weight of 708.14 g/mol. Its IUPAC name is 2-[2-[4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]ethenyl]-5-[(4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]benzenesulfonic acid.
| Compound Name | 2-[2-[4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]ethenyl]-5-[(4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 87355406 |
| Molecular Formula | C26H26ClN9O9S2 |
| Molecular Weight | 708.14 g/mol |
| Exact Mass | 707.10 |
| IUPAC Name | 2-[2-[4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]ethenyl]-5-[(4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]benzenesulfonic acid |
| SMILES | COc1nc(Cl)nc(Nc2ccc(C=Cc3ccc(Nc4nc(OC)nc(N5CCOCC5)n4)cc3S(=O)(=O)O)c(S(=O)(=O)O)c2)n1 |
| InChI | InChI=1S/C26H26ClN9O9S2/c1-43-25-31-21(27)30-22(33-25)28-17-7-5-15(19(13-17)46(37,38)39)3-4-16-6-8-18(14-20(16)47(40,41)42)29-23-32-24(35-26(34-23)44-2)36-9-11-45-12-10-36/h3-8,13-14H,9-12H2,1-2H3,(H,37,38,39)(H,40,41,42)(H,28,30,31,33)(H,29,32,34,35) |
| InChIKey | WEQLLGXHCXRVLR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 241.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.14 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|