C40H38N10O2 — CID 70504908
4-[2-(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)-1,2-diphenylethenyl]-6-morpholin-4-yl-N-phenyl-1,3,5-triazin-2-amine (PubChem CID 70504908) has the molecular formula C40H38N10O2 and a molecular weight of 690.81 g/mol. Its IUPAC name is 4-[2-(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)-1,2-diphenylethenyl]-6-morpholin-4-yl-N-phenyl-1,3,5-triazin-2-amine.
| Compound Name | 4-[2-(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)-1,2-diphenylethenyl]-6-morpholin-4-yl-N-phenyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 70504908 |
| Molecular Formula | C40H38N10O2 |
| Molecular Weight | 690.81 g/mol |
| Exact Mass | 690.32 |
| IUPAC Name | 4-[2-(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)-1,2-diphenylethenyl]-6-morpholin-4-yl-N-phenyl-1,3,5-triazin-2-amine |
| SMILES | c1ccc(Nc2nc(C(=C(c3ccccc3)c3nc(Nc4ccccc4)nc(N4CCOCC4)n3)c3ccccc3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C40H38N10O2/c1-5-13-29(14-6-1)33(35-43-37(41-31-17-9-3-10-18-31)47-39(45-35)49-21-25-51-26-22-49)34(30-15-7-2-8-16-30)36-44-38(42-32-19-11-4-12-20-32)48-40(46-36)50-23-27-52-28-24-50/h1-20H,21-28H2,(H,41,43,45,47)(H,42,44,46,48) |
| InChIKey | QQAWLIXZZPJHNL-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 126.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.81 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|