C14H17N5O2 — CID 1077239
4-methoxy-6-morpholin-4-yl-N-phenyl-1,3,5-triazin-2-amine (PubChem CID 1077239) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is 4-methoxy-6-morpholin-4-yl-N-phenyl-1,3,5-triazin-2-amine.
| Compound Name | 4-methoxy-6-morpholin-4-yl-N-phenyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 1077239 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 4-methoxy-6-morpholin-4-yl-N-phenyl-1,3,5-triazin-2-amine |
| SMILES | COc1nc(Nc2ccccc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C14H17N5O2/c1-20-14-17-12(15-11-5-3-2-4-6-11)16-13(18-14)19-7-9-21-10-8-19/h2-6H,7-10H2,1H3,(H,15,16,17,18) |
| InChIKey | MZYPRZCKRNNKKY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |