C26H33N7O4 — CID 23816371
N-[2-[2-[2-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]ethoxy]ethoxy]ethyl]benzamide (PubChem CID 23816371) has the molecular formula C26H33N7O4 and a molecular weight of 507.60 g/mol. Its IUPAC name is N-[2-[2-[2-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]ethoxy]ethoxy]ethyl]benzamide.
| Compound Name | N-[2-[2-[2-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]ethoxy]ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 23816371 |
| Molecular Formula | C26H33N7O4 |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | N-[2-[2-[2-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]ethoxy]ethoxy]ethyl]benzamide |
| SMILES | O=C(NCCOCCOCCNc1nc(Nc2ccccc2)nc(N2CCOCC2)n1)c1ccccc1 |
| InChI | InChI=1S/C26H33N7O4/c34-23(21-7-3-1-4-8-21)27-11-15-35-19-20-36-16-12-28-24-30-25(29-22-9-5-2-6-10-22)32-26(31-24)33-13-17-37-18-14-33/h1-10H,11-20H2,(H,27,34)(H2,28,29,30,31,32) |
| InChIKey | RUKHGBQDENZQPQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|