C27H37N7O3 — CID 23928942
N-[2-[2-[2-[[4-anilino-6-(pentan-3-ylamino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide (PubChem CID 23928942) has the molecular formula C27H37N7O3 and a molecular weight of 507.64 g/mol. Its IUPAC name is N-[2-[2-[2-[[4-anilino-6-(pentan-3-ylamino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide.
| Compound Name | N-[2-[2-[2-[[4-anilino-6-(pentan-3-ylamino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 23928942 |
| Molecular Formula | C27H37N7O3 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.30 |
| IUPAC Name | N-[2-[2-[2-[[4-anilino-6-(pentan-3-ylamino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide |
| SMILES | CCC(CC)Nc1nc(NCCOCCOCCNC(=O)c2ccccc2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C27H37N7O3/c1-3-22(4-2)30-26-32-25(33-27(34-26)31-23-13-9-6-10-14-23)29-16-18-37-20-19-36-17-15-28-24(35)21-11-7-5-8-12-21/h5-14,22H,3-4,15-20H2,1-2H3,(H,28,35)(H3,29,30,31,32,33,34) |
| InChIKey | ZRJJTFNYSSXBCS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|