C32H43N11O8 — CID 23956823
(2S)-2-[[4-[4-[2-[2-(2-azidoethoxy)ethoxy]ethylcarbamoyl]anilino]-6-[2-[2-(2-benzamidoethoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]amino]propanoic acid (PubChem CID 23956823) has the molecular formula C32H43N11O8 and a molecular weight of 709.77 g/mol. Its IUPAC name is (2S)-2-[[4-[4-[2-[2-(2-azidoethoxy)ethoxy]ethylcarbamoyl]anilino]-6-[2-[2-(2-benzamidoethoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]amino]propanoic acid.
| Compound Name | (2S)-2-[[4-[4-[2-[2-(2-azidoethoxy)ethoxy]ethylcarbamoyl]anilino]-6-[2-[2-(2-benzamidoethoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 23956823 |
| Molecular Formula | C32H43N11O8 |
| Molecular Weight | 709.77 g/mol |
| Exact Mass | 709.33 |
| IUPAC Name | (2S)-2-[[4-[4-[2-[2-(2-azidoethoxy)ethoxy]ethylcarbamoyl]anilino]-6-[2-[2-(2-benzamidoethoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]amino]propanoic acid |
| SMILES | C[C@H](Nc1nc(NCCOCCOCCNC(=O)c2ccccc2)nc(Nc2ccc(C(=O)NCCOCCOCCN=[N+]=[N-])cc2)n1)C(=O)O |
| InChI | InChI=1S/C32H43N11O8/c1-23(29(46)47)38-31-40-30(36-13-17-50-20-19-48-15-11-34-27(44)24-5-3-2-4-6-24)41-32(42-31)39-26-9-7-25(8-10-26)28(45)35-12-16-49-21-22-51-18-14-37-43-33/h2-10,23H,11-22H2,1H3,(H,34,44)(H,35,45)(H,46,47)(H3,36,38,39,40,41,42)/t23-/m0/s1 |
| InChIKey | RDNNUYPWYNXSLS-QHCPKHFHSA-N |
| XLogP | 2.45 |
| TPSA | 255.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.77 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|