C36H45N11O6 — CID 71157533
N-[2-[2-(2-azidoethoxy)ethoxy]ethyl]-4-[[4-[5-(2-benzamidoethoxy)pentylamino]-6-(3-hydroxyanilino)-1,3,5-triazin-2-yl]amino]benzamide (PubChem CID 71157533) has the molecular formula C36H45N11O6 and a molecular weight of 727.83 g/mol. Its IUPAC name is N-[2-[2-(2-azidoethoxy)ethoxy]ethyl]-4-[[4-[5-(2-benzamidoethoxy)pentylamino]-6-(3-hydroxyanilino)-1,3,5-triazin-2-yl]amino]benzamide.
| Compound Name | N-[2-[2-(2-azidoethoxy)ethoxy]ethyl]-4-[[4-[5-(2-benzamidoethoxy)pentylamino]-6-(3-hydroxyanilino)-1,3,5-triazin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 71157533 |
| Molecular Formula | C36H45N11O6 |
| Molecular Weight | 727.83 g/mol |
| Exact Mass | 727.36 |
| IUPAC Name | N-[2-[2-(2-azidoethoxy)ethoxy]ethyl]-4-[[4-[5-(2-benzamidoethoxy)pentylamino]-6-(3-hydroxyanilino)-1,3,5-triazin-2-yl]amino]benzamide |
| SMILES | [N-]=[N+]=NCCOCCOCCNC(=O)c1ccc(Nc2nc(NCCCCCOCCNC(=O)c3ccccc3)nc(Nc3cccc(O)c3)n2)cc1 |
| InChI | InChI=1S/C36H45N11O6/c37-47-41-19-23-53-25-24-52-22-18-39-33(50)28-12-14-29(15-13-28)42-35-44-34(45-36(46-35)43-30-10-7-11-31(48)26-30)40-16-5-2-6-20-51-21-17-38-32(49)27-8-3-1-4-9-27/h1,3-4,7-15,26,48H,2,5-6,16-25H2,(H,38,49)(H,39,50)(H3,40,42,43,44,45,46) |
| InChIKey | PDBOPVLXYYRMLG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 229.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 53 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.83 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|