C36H37N7O5 — CID 153035461
4-[[4-(4-hydroxyanilino)-6-[2-[2-(4-oxo-4-phenylbutoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]amino]-N-phenylbenzamide (PubChem CID 153035461) has the molecular formula C36H37N7O5 and a molecular weight of 647.74 g/mol. Its IUPAC name is 4-[[4-(4-hydroxyanilino)-6-[2-[2-(4-oxo-4-phenylbutoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]amino]-N-phenylbenzamide.
| Compound Name | 4-[[4-(4-hydroxyanilino)-6-[2-[2-(4-oxo-4-phenylbutoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]amino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 153035461 |
| Molecular Formula | C36H37N7O5 |
| Molecular Weight | 647.74 g/mol |
| Exact Mass | 647.29 |
| IUPAC Name | 4-[[4-(4-hydroxyanilino)-6-[2-[2-(4-oxo-4-phenylbutoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]amino]-N-phenylbenzamide |
| SMILES | O=C(CCCOCCOCCNc1nc(Nc2ccc(O)cc2)nc(Nc2ccc(C(=O)Nc3ccccc3)cc2)n1)c1ccccc1 |
| InChI | InChI=1S/C36H37N7O5/c44-31-19-17-30(18-20-31)40-36-42-34(37-21-23-48-25-24-47-22-7-12-32(45)26-8-3-1-4-9-26)41-35(43-36)39-29-15-13-27(14-16-29)33(46)38-28-10-5-2-6-11-28/h1-6,8-11,13-20,44H,7,12,21-25H2,(H,38,46)(H3,37,39,40,41,42,43) |
| InChIKey | VEQNQZPHRNLMMR-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 159.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.74 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|