C30H32N6O6 — CID 157326985
4-[[4-(4-hydroxyanilino)-6-[2-[2-(4-oxo-4-phenylbutoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]amino]benzoic acid (PubChem CID 157326985) has the molecular formula C30H32N6O6 and a molecular weight of 572.62 g/mol. Its IUPAC name is 4-[[4-(4-hydroxyanilino)-6-[2-[2-(4-oxo-4-phenylbutoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]amino]benzoic acid.
| Compound Name | 4-[[4-(4-hydroxyanilino)-6-[2-[2-(4-oxo-4-phenylbutoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 157326985 |
| Molecular Formula | C30H32N6O6 |
| Molecular Weight | 572.62 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | 4-[[4-(4-hydroxyanilino)-6-[2-[2-(4-oxo-4-phenylbutoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2nc(NCCOCCOCCCC(=O)c3ccccc3)nc(Nc3ccc(O)cc3)n2)cc1 |
| InChI | InChI=1S/C30H32N6O6/c37-25-14-12-24(13-15-25)33-30-35-28(34-29(36-30)32-23-10-8-22(9-11-23)27(39)40)31-16-18-42-20-19-41-17-4-7-26(38)21-5-2-1-3-6-21/h1-3,5-6,8-15,37H,4,7,16-20H2,(H,39,40)(H3,31,32,33,34,35,36) |
| InChIKey | SQPIFXZFEQAHEV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 167.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.62 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|