C32H44N6O7 — CID 157222934
5-[2-[2-[[4-(4-hydroxyanilino)-6-[2-[2-(4-oxo-4-phenylbutoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]pentan-2-one (PubChem CID 157222934) has the molecular formula C32H44N6O7 and a molecular weight of 624.74 g/mol. Its IUPAC name is 5-[2-[2-[[4-(4-hydroxyanilino)-6-[2-[2-(4-oxo-4-phenylbutoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]pentan-2-one.
| Compound Name | 5-[2-[2-[[4-(4-hydroxyanilino)-6-[2-[2-(4-oxo-4-phenylbutoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]pentan-2-one |
|---|---|
| PubChem CID | 157222934 |
| Molecular Formula | C32H44N6O7 |
| Molecular Weight | 624.74 g/mol |
| Exact Mass | 624.33 |
| IUPAC Name | 5-[2-[2-[[4-(4-hydroxyanilino)-6-[2-[2-(4-oxo-4-phenylbutoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]pentan-2-one |
| SMILES | CC(=O)CCCOCCOCCNc1nc(NCCOCCOCCCC(=O)c2ccccc2)nc(Nc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C32H44N6O7/c1-25(39)7-5-17-42-21-23-44-19-15-33-30-36-31(38-32(37-30)35-27-11-13-28(40)14-12-27)34-16-20-45-24-22-43-18-6-10-29(41)26-8-3-2-4-9-26/h2-4,8-9,11-14,40H,5-7,10,15-24H2,1H3,(H3,33,34,35,36,37,38) |
| InChIKey | YIDPPUMNEPTCHQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 166.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.74 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|