C34H38N8O5 — CID 158588055
4-[[4-(4-hydroxyanilino)-6-[2-[2-(4-oxopentoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]amino]-N-(1H-indol-5-ylmethyl)benzamide (PubChem CID 158588055) has the molecular formula C34H38N8O5 and a molecular weight of 638.73 g/mol. Its IUPAC name is 4-[[4-(4-hydroxyanilino)-6-[2-[2-(4-oxopentoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]amino]-N-(1H-indol-5-ylmethyl)benzamide.
| Compound Name | 4-[[4-(4-hydroxyanilino)-6-[2-[2-(4-oxopentoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]amino]-N-(1H-indol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 158588055 |
| Molecular Formula | C34H38N8O5 |
| Molecular Weight | 638.73 g/mol |
| Exact Mass | 638.30 |
| IUPAC Name | 4-[[4-(4-hydroxyanilino)-6-[2-[2-(4-oxopentoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]amino]-N-(1H-indol-5-ylmethyl)benzamide |
| SMILES | CC(=O)CCCOCCOCCNc1nc(Nc2ccc(O)cc2)nc(Nc2ccc(C(=O)NCc3ccc4[nH]ccc4c3)cc2)n1 |
| InChI | InChI=1S/C34H38N8O5/c1-23(43)3-2-17-46-19-20-47-18-16-36-32-40-33(42-34(41-32)39-28-9-11-29(44)12-10-28)38-27-7-5-25(6-8-27)31(45)37-22-24-4-13-30-26(21-24)14-15-35-30/h4-15,21,35,44H,2-3,16-20,22H2,1H3,(H,37,45)(H3,36,38,39,40,41,42) |
| InChIKey | LECXIMKUUWKPGG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 175.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.73 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|